Promnesic, Anxiolytic and Antioxidant Effects of Glaucosciadium cordifolium (Boiss.) Burtt & Davis Essential Oil in a Zebrafish Model of Cognitive Impairment
| dc.contributor.author | Boiangiu, Razvan Stefan | |
| dc.contributor.author | Bagci, Eyup | |
| dc.contributor.author | Dumitru, Gabriela | |
| dc.contributor.author | Hritcu, Lucian | |
| dc.contributor.author | Todirascu-Ciornea, Elena | |
| dc.date.accessioned | 2026-08-12T18:08:12Z | |
| dc.date.issued | 2023 | |
| dc.department | Fırat Üniversitesi | |
| dc.description.abstract | The purpose of this study was to investigate the effect of Glaucosciadium cordifolium essential oil (GCEO, 25 and 150 mu L/L) on anxiety and learning and memory impairment induced by scopolamine (SCOP) in zebrafish. The chemical composition was analyzed by GC-MS, and the results showed that the highest content was limonene followed by alpha- and beta-pinene, p-cymene and alpha-phellandrene. The dementia model was induced by SCOP (100 mu M), whereas GCEO and galantamine (GAL, 1 mg/L) were delivered to the SCOP-induced model. It was found that GCEO significantly improved memory impairment and anxiety-like response induced by SCOP through the Y-maze, novel object recognition (NOR) test, and novel tank diving tests (NTT). Biochemical analyses showed that GCEO reduced SCOP-induced oxidative damage. Additionally, the cholinergic system activity was improved in the SCOP-induced model by decreasing the acetylcholinesterase (AChE) activity following the exposure to GCEO. It was clear that as a mixture, GCEO displays positive action in improving memory impairment through restoring cholinergic dysfunction and brain antioxidant status. | |
| dc.description.sponsorship | Ministry of Research, Innovation and Digitization, CNCS-UEFISCDI, within PNCDI III [PN-III-P4-PCE-2021-1692] | |
| dc.description.sponsorship | L.H. and R.S.B. were supported by a grant of the Ministry of Research, Innovation and Digitization, CNCS-UEFISCDI, project number PN-III-P4-PCE-2021-1692, within PNCDI III. | |
| dc.identifier.doi | 10.3390/plants12040784 | |
| dc.identifier.issn | 2223-7747 | |
| dc.identifier.issue | 4 | |
| dc.identifier.orcid | 0000-0002-2602-4882 | |
| dc.identifier.orcid | 0000-0001-6981-4174 | |
| dc.identifier.pmid | 36840131 | |
| dc.identifier.scopus | 2-s2.0-85149219378 | |
| dc.identifier.scopusquality | Q1 | |
| dc.identifier.uri | https://doi.org/10.3390/plants12040784 | |
| dc.identifier.uri | https://hdl.handle.net/11508/62998 | |
| dc.identifier.volume | 12 | |
| dc.identifier.wos | WOS:000941615200001 | |
| dc.identifier.wosquality | Q1 | |
| dc.indekslendigikaynak | Web of Science | |
| dc.indekslendigikaynak | Scopus | |
| dc.indekslendigikaynak | PubMed | |
| dc.language.iso | en | |
| dc.publisher | Mdpi | |
| dc.relation.ispartof | Plants-Basel | |
| dc.relation.publicationcategory | Makale - Uluslararası Hakemli Dergi - Kurum Öğretim Elemanı | |
| dc.rights | info:eu-repo/semantics/openAccess | |
| dc.snmz | KA_WoS_20260511 | |
| dc.subject | Glaucosciadium cordifolium | |
| dc.subject | zebrafish | |
| dc.subject | memory | |
| dc.subject | anxiety | |
| dc.subject | oxidative stress | |
| dc.subject | scopolamine | |
| dc.subject | Alzheimer's disease | |
| dc.title | Promnesic, Anxiolytic and Antioxidant Effects of Glaucosciadium cordifolium (Boiss.) Burtt & Davis Essential Oil in a Zebrafish Model of Cognitive Impairment | |
| dc.type | Article |







