MHD thermogravitational convection and thermal radiation of a micropolar nanoliquid in a porous chamber
| dc.contributor.author | Izadi, Mohsen | |
| dc.contributor.author | Sheremet, Mikhail A. | |
| dc.contributor.author | Mehryan, S. A. M. | |
| dc.contributor.author | Pop, I. | |
| dc.contributor.author | Ortop, Hakan F. | |
| dc.contributor.author | Abu-Hamdeh, Nidal | |
| dc.date.accessioned | 2026-08-12T17:50:07Z | |
| dc.date.issued | 2020 | |
| dc.department | Fırat Üniversitesi | |
| dc.description.abstract | This work studies the thermogravitational transmission and thermal radiation of micropolar nanoliquid within a porous chamber in the presence of the uniform magnetic influence. The model includes the single-phase nanofluid approach, local thermal equilibrium approximation and Darcy law for the processes within the porous structure. The Galerkin finite element method with the structured non-uniform mesh is used to calculate the formulated equations. The key characteristics are the Darcy-Rayleigh number Ra = 10-1000, Darcy number D-a = 10(-5)-10(-1), porosity epsilon = 0.1-0.9, nanoparticles concentration phi = 0-0.04, radiation parameter R-d = 0-2, vortex viscosity characteristic Delta = 0-2, and Hartmann number Ha = 0-50. It has been ascertained the energy transport intensification with thermal radiation parameter, Darcy-Rayleigh number, porosity and nanoparticles concentration. Also, the results indicate that the average Nusselt number reduces with an increment of the Hartmann number for high values of the Rayleigh number, while for low magnitudes of the Rayleigh number a weak change of the average Nusselt number can be found. | |
| dc.description.sponsorship | UEFISCDI, Romania [PN-III-P4-IDPCE-2016-0036]; [17-79-20141]; Russian Science Foundation [17-79-20141] Funding Source: Russian Science Foundation | |
| dc.description.sponsorship | This work of I. Pop has been supported from the grant PN-III-P4-IDPCE-2016-0036, UEFISCDI, Romania. This work of M. Sheremet has been supported by the Russian Science Foundation (Project No. 17-79-20141). | |
| dc.identifier.doi | 10.1016/j.icheatmasstransfer.2019.104409 | |
| dc.identifier.issn | 0735-1933 | |
| dc.identifier.issn | 1879-0178 | |
| dc.identifier.orcid | 0000-0002-0660-6543 | |
| dc.identifier.orcid | 0000-0001-7323-6899 | |
| dc.identifier.orcid | 0000-0001-8812-5905 | |
| dc.identifier.scopus | 2-s2.0-85075280215 | |
| dc.identifier.scopusquality | Q1 | |
| dc.identifier.uri | https://doi.org/10.1016/j.icheatmasstransfer.2019.104409 | |
| dc.identifier.uri | https://hdl.handle.net/11508/62072 | |
| dc.identifier.volume | 110 | |
| dc.identifier.wos | WOS:000513295500020 | |
| dc.identifier.wosquality | Q1 | |
| dc.indekslendigikaynak | Web of Science | |
| dc.indekslendigikaynak | Scopus | |
| dc.language.iso | en | |
| dc.publisher | Pergamon-Elsevier Science Ltd | |
| dc.relation.ispartof | International Communications in Heat and Mass Transfer | |
| dc.relation.publicationcategory | Makale - Uluslararası Hakemli Dergi - Kurum Öğretim Elemanı | |
| dc.rights | info:eu-repo/semantics/closedAccess | |
| dc.snmz | KA_WoS_20260511 | |
| dc.subject | Natural convection | |
| dc.subject | Magnetic field | |
| dc.subject | Micropolar nanoliquid | |
| dc.subject | Porous cavity | |
| dc.subject | Elliptic heater | |
| dc.subject | Local thermal equilibrium model | |
| dc.title | MHD thermogravitational convection and thermal radiation of a micropolar nanoliquid in a porous chamber | |
| dc.type | Article |







